C26H19BO5 — CID 22818600
(1R,17S)-17-acetyl-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),4,6,8,10,12-hexaene-3,14-dione (PubChem CID 22818600) has the molecular formula C26H19BO5 and a molecular weight of 422.25 g/mol. Its IUPAC name is (1R,17S)-17-acetyl-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),4,6,8,10,12-hexaene-3,14-dione.
| Compound Name | (1R,17S)-17-acetyl-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),4,6,8,10,12-hexaene-3,14-dione |
|---|---|
| PubChem CID | 22818600 |
| Molecular Formula | C26H19BO5 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1R,17S)-17-acetyl-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),4,6,8,10,12-hexaene-3,14-dione |
| SMILES | CC(=O)[C@]12CC3=C(C(=O)c4cc5ccccc5cc4C3=O)[C@@H](C1)OB(c1ccccc1)O2 |
| InChI | InChI=1S/C26H19BO5/c1-15(28)26-13-21-23(22(14-26)31-27(32-26)18-9-3-2-4-10-18)25(30)20-12-17-8-6-5-7-16(17)11-19(20)24(21)29/h2-12,22H,13-14H2,1H3/t22-,26+/m1/s1 |
| InChIKey | DHIYKQFCVCDHGQ-GJZUVCINSA-N |
| XLogP | 3.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|