C15H24F2O4 — CID 22818879
(3aR,4R,5S,6aS)-3a,6a-difluoro-4-[(E)-3-hydroxyoct-1-enyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 22818879) has the molecular formula C15H24F2O4 and a molecular weight of 306.35 g/mol. Its IUPAC name is (3aR,4R,5S,6aS)-3a,6a-difluoro-4-[(E)-3-hydroxyoct-1-enyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5S,6aS)-3a,6a-difluoro-4-[(E)-3-hydroxyoct-1-enyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 22818879 |
| Molecular Formula | C15H24F2O4 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3aR,4R,5S,6aS)-3a,6a-difluoro-4-[(E)-3-hydroxyoct-1-enyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCCCC(O)/C=C/[C@@H]1[C@@H](O)C[C@@]2(F)OC(O)C[C@@]12F |
| InChI | InChI=1S/C15H24F2O4/c1-2-3-4-5-10(18)6-7-11-12(19)8-15(17)14(11,16)9-13(20)21-15/h6-7,10-13,18-20H,2-5,8-9H2,1H3/b7-6+/t10?,11-,12+,13?,14-,15-/m1/s1 |
| InChIKey | KJCHTIYKUFVMEY-IDNNLYKHSA-N |
| XLogP | 1.98 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|