C15H16F3NO6S — CID 22818911
(3S)-2-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid (PubChem CID 22818911) has the molecular formula C15H16F3NO6S and a molecular weight of 395.36 g/mol. Its IUPAC name is (3S)-2-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid.
| Compound Name | (3S)-2-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 22818911 |
| Molecular Formula | C15H16F3NO6S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (3S)-2-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid |
| SMILES | CC(=O)SCC(C(=O)N1CC2(C[C@H]1C(=O)O)C(=O)CCC2=O)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO6S/c1-7(20)26-5-8(15(16,17)18)12(23)19-6-14(4-9(19)13(24)25)10(21)2-3-11(14)22/h8-9H,2-6H2,1H3,(H,24,25)/t8?,9-/m0/s1 |
| InChIKey | BAPAPYNGKSPYCX-GKAPJAKFSA-N |
| XLogP | 1.05 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|