About methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate
methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22819101) has the molecular formula C26H44O6
and a molecular weight of 452.63 g/mol. Its IUPAC name is methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate |
| PubChem CID | 22819101 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(C=C[C@H]1CCC(=O)[C@@H]1C(O)CCCCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C26H44O6/c1-3-4-6-11-21(32-25-14-9-10-19-31-25)17-15-20-16-18-23(28)26(20)22(27)12-7-5-8-13-24(29)30-2/h15,17,20-22,25-27H,3-14,16,18-19H2,1-2H3/t20-,21?,22?,25?,26-/m0/s1 |
| InChIKey | NXOCTZRVYIKLRC-USFALJQGSA-N |
| XLogP | 5.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate?
The IUPAC name of methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate (CID 22819101) is methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate?
The canonical SMILES for methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate is CCCCCC(C=C[C@H]1CCC(=O)[C@@H]1C(O)CCCCCC(=O)OC)OC1CCCCO1.
What is the InChIKey of methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate?
The InChIKey is NXOCTZRVYIKLRC-USFALJQGSA-N. The full InChI is InChI=1S/C26H44O6/c1-3-4-6-11-21(32-25-14-9-10-19-31-25)17-15-20-16-18-23(28)26(20)22(27)12-7-5-8-13-24(29)30-2/h15,17,20-22,25-27H,3-14,16,18-19H2,1-2H3/t20-,21?,22?,25?,26-/m0/s1.
What are the key properties of methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate?
methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate has a molecular weight of 452.63 g/mol, XLogP of 5.11, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-hydroxy-7-[(1S,2R)-2-[3-(oxan-2-yloxy)oct-1-enyl]-5-oxocyclopentyl]heptanoate is sourced from PubChem (CID 22819101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).