C17H19N3O7S — CID 22819417
methyl (6S)-7-[[2-amino-2-(2,5-dihydroxyphenyl)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22819417) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is methyl (6S)-7-[[2-amino-2-(2,5-dihydroxyphenyl)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | methyl (6S)-7-[[2-amino-2-(2,5-dihydroxyphenyl)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22819417 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | methyl (6S)-7-[[2-amino-2-(2,5-dihydroxyphenyl)acetyl]amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(OC)CS[C@H]2C(NC(=O)C(N)c3cc(O)ccc3O)C(=O)N12 |
| InChI | InChI=1S/C17H19N3O7S/c1-26-10-6-28-16-12(15(24)20(16)13(10)17(25)27-2)19-14(23)11(18)8-5-7(21)3-4-9(8)22/h3-5,11-12,16,21-22H,6,18H2,1-2H3,(H,19,23)/t11?,12?,16-/m0/s1 |
| InChIKey | LIMPXSDHHVYZST-PPUFBPAQSA-N |
| XLogP | -0.47 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|