C8H8F4O4 — CID 22819799
methyl 2-[(1S,5S)-4,4-difluoro-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2,2-difluoroacetate (PubChem CID 22819799) has the molecular formula C8H8F4O4 and a molecular weight of 244.14 g/mol. Its IUPAC name is methyl 2-[(1S,5S)-4,4-difluoro-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2,2-difluoroacetate.
| Compound Name | methyl 2-[(1S,5S)-4,4-difluoro-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 22819799 |
| Molecular Formula | C8H8F4O4 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | methyl 2-[(1S,5S)-4,4-difluoro-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2,2-difluoroacetate |
| SMILES | COC(=O)C(F)(F)C1C(O)C(F)(F)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C8H8F4O4/c1-15-6(14)7(9,10)2-3-5(16-3)8(11,12)4(2)13/h2-5,13H,1H3/t2?,3-,4?,5-/m0/s1 |
| InChIKey | HUZOVNXQBBQTSO-JKDPMYMHSA-N |
| XLogP | 0.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|