C18H17ClO7 — CID 22819953
(2-chloro-6-phenylphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 22819953) has the molecular formula C18H17ClO7 and a molecular weight of 380.78 g/mol. Its IUPAC name is (2-chloro-6-phenylphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | (2-chloro-6-phenylphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 22819953 |
| Molecular Formula | C18H17ClO7 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2-chloro-6-phenylphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | O=C(Oc1c(Cl)cccc1-c1ccccc1)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H17ClO7/c19-11-8-4-7-10(9-5-2-1-3-6-9)15(11)25-18(24)16-13(21)12(20)14(22)17(23)26-16/h1-8,12-14,16-17,20-23H/t12-,13-,14+,16-,17+/m0/s1 |
| InChIKey | GCBFXRGCNDDZEV-GFISCPRKSA-N |
| XLogP | 0.71 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|