C9H11Br2F3O2 — CID 22820051
trans-(1R,3S)-3-(2,2-dibromo-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 22820051) has the molecular formula C9H11Br2F3O2 and a molecular weight of 367.99 g/mol. Its IUPAC name is trans-(1R,3S)-3-(2,2-dibromo-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-(2,2-dibromo-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 22820051 |
| Molecular Formula | C9H11Br2F3O2 |
| Molecular Weight | 367.99 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | trans-(1R,3S)-3-(2,2-dibromo-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1CC(Br)(Br)C(F)(F)F |
| InChI | InChI=1S/C9H11Br2F3O2/c1-7(2)4(5(7)6(15)16)3-8(10,11)9(12,13)14/h4-5H,3H2,1-2H3,(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | QCVRYSISJUNXGD-WHFBIAKZSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.99 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|