C9H12ClF3O2 — CID 22820052
trans-(1R,3S)-3-(2-chloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 22820052) has the molecular formula C9H12ClF3O2 and a molecular weight of 244.64 g/mol. Its IUPAC name is trans-(1R,3S)-3-(2-chloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-(2-chloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 22820052 |
| Molecular Formula | C9H12ClF3O2 |
| Molecular Weight | 244.64 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | trans-(1R,3S)-3-(2-chloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1CC(Cl)C(F)(F)F |
| InChI | InChI=1S/C9H12ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h4-6H,3H2,1-2H3,(H,14,15)/t4-,5?,6-/m0/s1 |
| InChIKey | WXRPTWOZORWLQE-BZWZBFKDSA-N |
| XLogP | 2.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|