C10H18N2O2 — CID 22820329
[(4S,4aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl] carbamate (PubChem CID 22820329) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is [(4S,4aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl] carbamate.
| Compound Name | [(4S,4aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl] carbamate |
|---|---|
| PubChem CID | 22820329 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(4S,4aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl] carbamate |
| SMILES | NC(=O)O[C@H]1CCNC2CCCC[C@H]21 |
| InChI | InChI=1S/C10H18N2O2/c11-10(13)14-9-5-6-12-8-4-2-1-3-7(8)9/h7-9,12H,1-6H2,(H2,11,13)/t7-,8?,9+/m1/s1 |
| InChIKey | GQBQHWXLLDOENG-NBXIYJJMSA-N |
| XLogP | 1.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |