C11H21NO5 — CID 22821488
(2S,3R,4S,5S)-1-(1-deuterioprop-2-enyl)-2-[(1R)-1,3-dihydroxypropyl]piperidine-3,4,5-triol (PubChem CID 22821488) has the molecular formula C11H21NO5 and a molecular weight of 248.30 g/mol. Its IUPAC name is (2S,3R,4S,5S)-1-(1-deuterioprop-2-enyl)-2-[(1R)-1,3-dihydroxypropyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-1-(1-deuterioprop-2-enyl)-2-[(1R)-1,3-dihydroxypropyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 22821488 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2S,3R,4S,5S)-1-(1-deuterioprop-2-enyl)-2-[(1R)-1,3-dihydroxypropyl]piperidine-3,4,5-triol |
| SMILES | [2H]C(C=C)N1C[C@H](O)[C@H](O)[C@H](O)[C@@H]1[C@H](O)CCO |
| InChI | InChI=1S/C11H21NO5/c1-2-4-12-6-8(15)10(16)11(17)9(12)7(14)3-5-13/h2,7-11,13-17H,1,3-6H2/t7-,8+,9+,10+,11-/m1/s1/i4D/t4?,7-,8+,9+,10+,11- |
| InChIKey | MNPRPBSHBBLKDE-NVVGCSAZSA-N |
| XLogP | -2.32 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|