C14H28O5Si — CID 22821530
2-[(1S,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 22821530) has the molecular formula C14H28O5Si and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-[(1S,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 22821530 |
| Molecular Formula | C14H28O5Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[(1S,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](CC(=O)O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C14H28O5Si/c1-14(2,3)20(4,5)19-8-10-9(6-13(17)18)11(15)7-12(10)16/h9-12,15-16H,6-8H2,1-5H3,(H,17,18)/t9-,10-,11+,12-/m0/s1 |
| InChIKey | HZTHKPCCLCEMCA-YFKTTZPYSA-N |
| XLogP | 1.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|