C18H28N2O6 — CID 22821647
(2S)-2-amino-4-methylpentanoic acid;(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid (PubChem CID 22821647) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 22821647 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.N[C@@H](CCC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H15NO4.C6H13NO2/c13-10(12(15)16)6-7-11(14)17-8-9-4-2-1-3-5-9;1-4(2)3-5(7)6(8)9/h1-5,10H,6-8,13H2,(H,15,16);4-5H,3,7H2,1-2H3,(H,8,9)/t10-;5-/m00/s1 |
| InChIKey | WBLMXCMIFMRDHG-PTKYJSHISA-N |
| XLogP | 1.37 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |