C6H12O5 — CID 22821812
(3S,4R,5S)-3,4,5,6-tetrahydroxyhexan-2-one (PubChem CID 22821812) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (3S,4R,5S)-3,4,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3S,4R,5S)-3,4,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 22821812 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (3S,4R,5S)-3,4,5,6-tetrahydroxyhexan-2-one |
| SMILES | CC(=O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h4-7,9-11H,2H2,1H3/t4-,5+,6+/m0/s1 |
| InChIKey | IXDZFGATLNCIOI-KVQBGUIXSA-N |
| XLogP | -2.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |