C17H28O3 — CID 22822059
(3aS,4R,5R,6aR)-5-hydroxy-4-[(E)-9-hydroxynon-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 22822059) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-hydroxy-4-[(E)-9-hydroxynon-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-hydroxy-4-[(E)-9-hydroxynon-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 22822059 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-hydroxy-4-[(E)-9-hydroxynon-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](O)[C@H](/C=C/CCCCCCCO)[C@H]2C1 |
| InChI | InChI=1S/C17H28O3/c18-9-7-5-3-1-2-4-6-8-15-16-12-14(19)10-13(16)11-17(15)20/h6,8,13,15-18,20H,1-5,7,9-12H2/b8-6+/t13-,15+,16-,17+/m0/s1 |
| InChIKey | GDLXSQJXDJDPQJ-CGFTVZPYSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|