C16H28O5Si — CID 22822076
(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid (PubChem CID 22822076) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid.
| Compound Name | (3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid |
|---|---|
| PubChem CID | 22822076 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H]2CC(=O)C(C(=O)O)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C16H28O5Si/c1-16(2,3)22(4,5)21-8-11-9-6-13(18)14(15(19)20)10(9)7-12(11)17/h9-12,14,17H,6-8H2,1-5H3,(H,19,20)/t9-,10-,11+,12+,14?/m0/s1 |
| InChIKey | IDOZTSDLNOSDLS-PFMSDRGJSA-N |
| XLogP | 2.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|