C28H39NO6S — CID 22822895
[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 6-isothiocyanatohexanoate (PubChem CID 22822895) has the molecular formula C28H39NO6S and a molecular weight of 517.69 g/mol. Its IUPAC name is [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 6-isothiocyanatohexanoate.
| Compound Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 6-isothiocyanatohexanoate |
|---|---|
| PubChem CID | 22822895 |
| Molecular Formula | C28H39NO6S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 6-isothiocyanatohexanoate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)COC(=O)CCCCCN=C=S |
| InChI | InChI=1S/C28H39NO6S/c1-26-11-9-19(30)14-18(26)7-8-20-21-10-12-28(34,27(21,2)15-22(31)25(20)26)23(32)16-35-24(33)6-4-3-5-13-29-17-36/h14,20-22,25,31,34H,3-13,15-16H2,1-2H3/t20-,21-,22-,25+,26-,27-,28-/m0/s1 |
| InChIKey | NEFLRKQRIRMJKL-SLPNHVECSA-N |
| XLogP | 4.00 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|