C14H25NO5 — CID 22823701
(E,2S,3R,4R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoic acid (PubChem CID 22823701) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is (E,2S,3R,4R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoic acid.
| Compound Name | (E,2S,3R,4R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoic acid |
|---|---|
| PubChem CID | 22823701 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (E,2S,3R,4R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoic acid |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H25NO5/c1-6-7-8-9(2)11(16)10(12(17)18)15-13(19)20-14(3,4)5/h6-7,9-11,16H,8H2,1-5H3,(H,15,19)(H,17,18)/b7-6+/t9-,10+,11-/m1/s1 |
| InChIKey | PRWCFHHPMDELJR-VONSALPUSA-N |
| XLogP | 1.93 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|