C15H23NO7S — CID 22823759
2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-(hydroxymethyl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22823759) has the molecular formula C15H23NO7S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-(hydroxymethyl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-(hydroxymethyl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22823759 |
| Molecular Formula | C15H23NO7S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-(hydroxymethyl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)[C@H](CO)[C@H]2S(=O)C1(C)C |
| InChI | InChI=1S/C15H23NO7S/c1-14(2,3)13(20)23-7-22-12(19)9-15(4,5)24(21)11-8(6-17)10(18)16(9)11/h8-9,11,17H,6-7H2,1-5H3/t8-,9-,11+,24?/m0/s1 |
| InChIKey | DOAJBVCEONVVLL-QOWCAEACSA-N |
| XLogP | -0.24 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|