C21H52O6Si5 — CID 22824052
(3R,4R,5R)-4,5,6-trihydroxy-1,1,3-tris(trimethylsilyl)-1,3-bis(trimethylsilyloxy)hexan-2-one (PubChem CID 22824052) has the molecular formula C21H52O6Si5 and a molecular weight of 541.07 g/mol. Its IUPAC name is (3R,4R,5R)-4,5,6-trihydroxy-1,1,3-tris(trimethylsilyl)-1,3-bis(trimethylsilyloxy)hexan-2-one.
| Compound Name | (3R,4R,5R)-4,5,6-trihydroxy-1,1,3-tris(trimethylsilyl)-1,3-bis(trimethylsilyloxy)hexan-2-one |
|---|---|
| PubChem CID | 22824052 |
| Molecular Formula | C21H52O6Si5 |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (3R,4R,5R)-4,5,6-trihydroxy-1,1,3-tris(trimethylsilyl)-1,3-bis(trimethylsilyloxy)hexan-2-one |
| SMILES | C[Si](C)(C)OC(C(=O)[C@@](O[Si](C)(C)C)([C@H](O)[C@H](O)CO)[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H52O6Si5/c1-28(2,3)20(26-31(10,11)12,18(24)17(23)16-22)19(25)21(29(4,5)6,30(7,8)9)27-32(13,14)15/h17-18,22-24H,16H2,1-15H3/t17-,18-,20-/m1/s1 |
| InChIKey | AEQYAGJBVHYMFI-QWFCFKBJSA-N |
| XLogP | 4.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|