C27H34O5 — CID 22824976
[(1'R,2'R,3'aR,6'aS)-1'-[(E,3S)-3-hydroxy-4-methylnon-1-en-7-ynyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate (PubChem CID 22824976) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(1'R,2'R,3'aR,6'aS)-1'-[(E,3S)-3-hydroxy-4-methylnon-1-en-7-ynyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate.
| Compound Name | [(1'R,2'R,3'aR,6'aS)-1'-[(E,3S)-3-hydroxy-4-methylnon-1-en-7-ynyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
|---|---|
| PubChem CID | 22824976 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(1'R,2'R,3'aR,6'aS)-1'-[(E,3S)-3-hydroxy-4-methylnon-1-en-7-ynyl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
| SMILES | CC#CCCC(C)[C@H](O)/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1OC(=O)c1ccccc1)OCCO3 |
| InChI | InChI=1S/C27H34O5/c1-3-4-6-9-19(2)24(28)13-12-22-23-18-27(30-14-15-31-27)17-21(23)16-25(22)32-26(29)20-10-7-5-8-11-20/h5,7-8,10-13,19,21-25,28H,6,9,14-18H2,1-2H3/b13-12+/t19?,21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | FJRJDMIJCSJQIP-ALVLPPCESA-N |
| XLogP | 4.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|