C7H15FN2 — CID 22825129
(E)-6-fluoro-3-methylhex-2-ene-1,4-diamine (PubChem CID 22825129) has the molecular formula C7H15FN2 and a molecular weight of 146.21 g/mol. Its IUPAC name is (E)-6-fluoro-3-methylhex-2-ene-1,4-diamine.
| Compound Name | (E)-6-fluoro-3-methylhex-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 22825129 |
| Molecular Formula | C7H15FN2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | (E)-6-fluoro-3-methylhex-2-ene-1,4-diamine |
| SMILES | C/C(=C\CN)C(N)CCF |
| InChI | InChI=1S/C7H15FN2/c1-6(3-5-9)7(10)2-4-8/h3,7H,2,4-5,9-10H2,1H3/b6-3+ |
| InChIKey | NHLVWIAXMMNSPR-ZZXKWVIFSA-N |
| XLogP | 0.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|