C24H35FO6 — CID 22825394
(3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluoro-4-methylphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825394) has the molecular formula C24H35FO6 and a molecular weight of 438.54 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluoro-4-methylphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluoro-4-methylphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825394 |
| Molecular Formula | C24H35FO6 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluoro-4-methylphenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC1(CC)O[C@H]2O[C@H]([C@H]3COC(CC)(CC)O3)[C@H](OCc3ccc(C)cc3F)[C@H]2O1 |
| InChI | InChI=1S/C24H35FO6/c1-6-23(7-2)27-14-18(29-23)19-20(26-13-16-11-10-15(5)12-17(16)25)21-22(28-19)31-24(8-3,9-4)30-21/h10-12,18-22H,6-9,13-14H2,1-5H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | XJNDFUPXHSKJME-QMCAAQAGSA-N |
| XLogP | 4.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |