C23H33FO6 — CID 22825395
(3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluorophenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825395) has the molecular formula C23H33FO6 and a molecular weight of 424.51 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluorophenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluorophenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825395 |
| Molecular Formula | C23H33FO6 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-2,2-diethyl-6-[(2-fluorophenyl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC1(CC)O[C@H]2O[C@H]([C@H]3COC(CC)(CC)O3)[C@H](OCc3ccccc3F)[C@H]2O1 |
| InChI | InChI=1S/C23H33FO6/c1-5-22(6-2)26-14-17(28-22)18-19(25-13-15-11-9-10-12-16(15)24)20-21(27-18)30-23(7-3,8-4)29-20/h9-12,17-21H,5-8,13-14H2,1-4H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | PSWRWPJCUIFIFA-YMQHIKHWSA-N |
| XLogP | 4.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |