C20H28N6O5S — CID 22825665
(2S,5R,6R)-3,3-dimethyl-6-[[4-[3-(2-nitroimidazol-1-yl)propyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22825665) has the molecular formula C20H28N6O5S and a molecular weight of 464.55 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-6-[[4-[3-(2-nitroimidazol-1-yl)propyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-6-[[4-[3-(2-nitroimidazol-1-yl)propyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22825665 |
| Molecular Formula | C20H28N6O5S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-6-[[4-[3-(2-nitroimidazol-1-yl)propyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](/N=C/N3CCC(CCCn4ccnc4[N+](=O)[O-])CC3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C20H28N6O5S/c1-20(2)15(18(28)29)25-16(27)14(17(25)32-20)22-12-23-9-5-13(6-10-23)4-3-8-24-11-7-21-19(24)26(30)31/h7,11-15,17H,3-6,8-10H2,1-2H3,(H,28,29)/b22-12+/t14-,15+,17-/m1/s1 |
| InChIKey | LWIIUXBMTPJHRQ-UTEPHESZSA-N |
| XLogP | 1.83 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|