C24H38O6 — CID 22825851
(2R,3R,4R,5S)-1,2,3,4,5,6-hexakis(prop-2-enoxy)hexane (PubChem CID 22825851) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1,2,3,4,5,6-hexakis(prop-2-enoxy)hexane.
| Compound Name | (2R,3R,4R,5S)-1,2,3,4,5,6-hexakis(prop-2-enoxy)hexane |
|---|---|
| PubChem CID | 22825851 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2R,3R,4R,5S)-1,2,3,4,5,6-hexakis(prop-2-enoxy)hexane |
| SMILES | C=CCOC[C@H](OCC=C)[C@@H](OCC=C)[C@H](OCC=C)[C@@H](COCC=C)OCC=C |
| InChI | InChI=1S/C24H38O6/c1-7-13-25-19-21(27-15-9-3)23(29-17-11-5)24(30-18-12-6)22(28-16-10-4)20-26-14-8-2/h7-12,21-24H,1-6,13-20H2/t21-,22+,23-,24-/m1/s1 |
| InChIKey | RZFOEAPJPZMXTQ-UEQSERJNSA-N |
| XLogP | 3.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|