C11H13N3O5S — CID 22826427
(6R,7R)-3-(acetyloxymethyl)-7-carbamimidoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22826427) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-carbamimidoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-carbamimidoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22826427 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-carbamimidoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(\N)[C@@H]1C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C11H13N3O5S/c1-4(15)19-2-5-3-20-10-6(8(12)13)9(16)14(10)7(5)11(17)18/h6,10H,2-3H2,1H3,(H3,12,13)(H,17,18)/t6-,10-/m1/s1 |
| InChIKey | SSJUUQQNXDCCOF-LHLIQPBNSA-N |
| XLogP | -0.64 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|