About (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid
(2S)-3,4-dimethyl-2-(methylamino)pentanoic acid (PubChem CID 22826857) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid.
Molecular Properties
| Compound Name | (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid |
| PubChem CID | 22826857 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid |
| SMILES | CN[C@H](C(=O)O)C(C)C(C)C |
| InChI | InChI=1S/C8H17NO2/c1-5(2)6(3)7(9-4)8(10)11/h5-7,9H,1-4H3,(H,10,11)/t6?,7-/m0/s1 |
| InChIKey | APNZXFAZHQHILW-MLWJPKLSSA-N |
| XLogP | 0.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid?
The IUPAC name of (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid (CID 22826857) is (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid.
What is the SMILES notation for (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid?
The canonical SMILES for (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid is CN[C@H](C(=O)O)C(C)C(C)C.
What is the InChIKey of (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid?
The InChIKey is APNZXFAZHQHILW-MLWJPKLSSA-N. The full InChI is InChI=1S/C8H17NO2/c1-5(2)6(3)7(9-4)8(10)11/h5-7,9H,1-4H3,(H,10,11)/t6?,7-/m0/s1.
What are the key properties of (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid?
(2S)-3,4-dimethyl-2-(methylamino)pentanoic acid has a molecular weight of 159.23 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-dimethyl-2-(methylamino)pentanoic acid is sourced from PubChem (CID 22826857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).