C16H24O6 — CID 22827171
CID 22827171 (PubChem CID 22827171) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol.
| Compound Name | CID 22827171 |
|---|---|
| PubChem CID | 22827171 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | — |
| SMILES | OC[C@@]12O[C@H]3COC4(CCCC4)O[C@H]3[C@@H]1OC1(CCCC1)O2 |
| InChI | InChI=1S/C16H24O6/c17-10-16-13(21-15(22-16)7-3-4-8-15)12-11(19-16)9-18-14(20-12)5-1-2-6-14/h11-13,17H,1-10H2/t11-,12+,13-,16-/m0/s1 |
| InChIKey | MIXPRKGBWRGHAS-ZWUHOBOKSA-N |
| XLogP | 1.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |