About CID 22827171
CID 22827171 (PubChem CID 22827171) has the molecular formula C16H24O6
and a molecular weight of 312.36 g/mol.
Molecular Properties
| Compound Name | CID 22827171 |
| PubChem CID | 22827171 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | — |
| SMILES | OC[C@@]12O[C@H]3COC4(CCCC4)O[C@H]3[C@@H]1OC1(CCCC1)O2 |
| InChI | InChI=1S/C16H24O6/c17-10-16-13(21-15(22-16)7-3-4-8-15)12-11(19-16)9-18-14(20-12)5-1-2-6-14/h11-13,17H,1-10H2/t11-,12+,13-,16-/m0/s1 |
| InChIKey | MIXPRKGBWRGHAS-ZWUHOBOKSA-N |
| XLogP | 1.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 22827171 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22827171?
The IUPAC name of CID 22827171 (CID 22827171) is not available.
What is the SMILES notation for CID 22827171?
The canonical SMILES for CID 22827171 is OC[C@@]12O[C@H]3COC4(CCCC4)O[C@H]3[C@@H]1OC1(CCCC1)O2.
What is the InChIKey of CID 22827171?
The InChIKey is MIXPRKGBWRGHAS-ZWUHOBOKSA-N. The full InChI is InChI=1S/C16H24O6/c17-10-16-13(21-15(22-16)7-3-4-8-15)12-11(19-16)9-18-14(20-12)5-1-2-6-14/h11-13,17H,1-10H2/t11-,12+,13-,16-/m0/s1.
What are the key properties of CID 22827171?
CID 22827171 has a molecular weight of 312.36 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22827171 is sourced from PubChem (CID 22827171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).