C17H17NO3S — CID 22827572
(4R)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 22827572) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is (4R)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22827572 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (4R)-2-(2-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(c2ccccc2OCc2ccccc2)N1 |
| InChI | InChI=1S/C17H17NO3S/c19-17(20)14-11-22-16(18-14)13-8-4-5-9-15(13)21-10-12-6-2-1-3-7-12/h1-9,14,16,18H,10-11H2,(H,19,20)/t14-,16?/m0/s1 |
| InChIKey | BJFUKTAYLUOPFA-LBAUFKAWSA-N |
| XLogP | 3.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |