About benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride
benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 22827650) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| PubChem CID | 22827650 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C12H15NO2.ClH/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10;/h1-3,5-6,11,13H,4,7-9H2;1H/t11-;/m1./s1 |
| InChIKey | NEDMOHHWRPHBAL-RFVHGSKJSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The IUPAC name of benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (CID 22827650) is benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride.
What is the SMILES notation for benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The canonical SMILES for benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride is Cl.O=C(OCc1ccccc1)[C@H]1CCCN1.
What is the InChIKey of benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The InChIKey is NEDMOHHWRPHBAL-RFVHGSKJSA-N. The full InChI is InChI=1S/C12H15NO2.ClH/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10;/h1-3,5-6,11,13H,4,7-9H2;1H/t11-;/m1./s1.
What are the key properties of benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride has a molecular weight of 241.72 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 22827650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).