C20H28O3S — CID 22827964
7-[(1R,2R,3S,4S)-3-(phenylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 22827964) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(phenylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(phenylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 22827964 |
| Molecular Formula | C20H28O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(phenylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@H](CSc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C20H28O3S/c21-20(22)11-7-2-1-6-10-16-17(19-13-12-18(16)23-19)14-24-15-8-4-3-5-9-15/h3-5,8-9,16-19H,1-2,6-7,10-14H2,(H,21,22)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | UYZUXXZQCQDSQB-HCXYKTFWSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|