C19H31Cl2N3 — CID 22828625
(1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride (PubChem CID 22828625) has the molecular formula C19H31Cl2N3 and a molecular weight of 372.38 g/mol. Its IUPAC name is (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride.
| Compound Name | (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride |
|---|---|
| PubChem CID | 22828625 |
| Molecular Formula | C19H31Cl2N3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride |
| SMILES | CCN1CCN(CC)[C@H]2C1C(C)=CN1C3=C(CCC=C3)C[C@@H]21.Cl.Cl |
| InChI | InChI=1S/C19H29N3.2ClH/c1-4-20-10-11-21(5-2)19-17-12-15-8-6-7-9-16(15)22(17)13-14(3)18(19)20;;/h7,9,13,17-19H,4-6,8,10-12H2,1-3H3;2*1H/t17-,18?,19+;;/m0../s1 |
| InChIKey | SBBZKYJJGZUDIR-VAZZKRJKSA-N |
| XLogP | 3.82 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |