C19H29N3 — CID 22828626
(1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene (PubChem CID 22828626) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene.
| Compound Name | (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
|---|---|
| PubChem CID | 22828626 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (1S,2R)-3,6-diethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
| SMILES | CCN1CCN(CC)[C@H]2C1C(C)=CN1C3=C(CCC=C3)C[C@@H]21 |
| InChI | InChI=1S/C19H29N3/c1-4-20-10-11-21(5-2)19-17-12-15-8-6-7-9-16(15)22(17)13-14(3)18(19)20/h7,9,13,17-19H,4-6,8,10-12H2,1-3H3/t17-,18?,19+/m0/s1 |
| InChIKey | DDKLDPHTBBXVOX-LJJQOFDWSA-N |
| XLogP | 2.98 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |