C21H35Cl2N3 — CID 22828627
(1S,2S)-6-butyl-3-ethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride (PubChem CID 22828627) has the molecular formula C21H35Cl2N3 and a molecular weight of 400.44 g/mol. Its IUPAC name is (1S,2S)-6-butyl-3-ethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride.
| Compound Name | (1S,2S)-6-butyl-3-ethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride |
|---|---|
| PubChem CID | 22828627 |
| Molecular Formula | C21H35Cl2N3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (1S,2S)-6-butyl-3-ethyl-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrochloride |
| SMILES | CCCCN1CCN(CC)[C@@H]2C1C(C)=CN1C3=C(CCC=C3)C[C@@H]21.Cl.Cl |
| InChI | InChI=1S/C21H33N3.2ClH/c1-4-6-11-23-13-12-22(5-2)21-19-14-17-9-7-8-10-18(17)24(19)15-16(3)20(21)23;;/h8,10,15,19-21H,4-7,9,11-14H2,1-3H3;2*1H/t19-,20?,21-;;/m0../s1 |
| InChIKey | MLOYJPOJRACUJS-JTONWGKHSA-N |
| XLogP | 4.60 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |