C17H25N3 — CID 22828633
(1S,2R)-3,6,8-trimethyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene (PubChem CID 22828633) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is (1S,2R)-3,6,8-trimethyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene.
| Compound Name | (1S,2R)-3,6,8-trimethyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
|---|---|
| PubChem CID | 22828633 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (1S,2R)-3,6,8-trimethyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
| SMILES | CC1=CN2C3=C(CCC=C3)C[C@H]2[C@@H]2C1N(C)CCN2C |
| InChI | InChI=1S/C17H25N3/c1-12-11-20-14-7-5-4-6-13(14)10-15(20)17-16(12)18(2)8-9-19(17)3/h5,7,11,15-17H,4,6,8-10H2,1-3H3/t15-,16?,17+/m0/s1 |
| InChIKey | LHCMGWRTSFDLPQ-RPCGPGEBSA-N |
| XLogP | 2.20 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |