C18H27N3 — CID 22828639
(1S,2R)-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene (PubChem CID 22828639) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (1S,2R)-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene.
| Compound Name | (1S,2R)-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
|---|---|
| PubChem CID | 22828639 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (1S,2R)-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
| SMILES | CC1=CN2C3=C(CCC=C3)C[C@H]2[C@H]2C1NCCN2C(C)C |
| InChI | InChI=1S/C18H27N3/c1-12(2)20-9-8-19-17-13(3)11-21-15-7-5-4-6-14(15)10-16(21)18(17)20/h5,7,11-12,16-19H,4,6,8-10H2,1-3H3/t16-,17?,18-/m0/s1 |
| InChIKey | WFKOSVNAEJAZJV-RGBJRUIASA-N |
| XLogP | 2.63 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |