C23H28O6 — CID 22828662
(1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-6-(4-ethylphenyl)-3-(4-methylphenyl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol (PubChem CID 22828662) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-6-(4-ethylphenyl)-3-(4-methylphenyl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol.
| Compound Name | (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-6-(4-ethylphenyl)-3-(4-methylphenyl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 22828662 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-6-(4-ethylphenyl)-3-(4-methylphenyl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol |
| SMILES | CCc1ccc(C2C(O)[C@@]3(O)C(c4ccc(C)cc4)[C@@](O)([C@H](O)CO)[C@@]23O)cc1 |
| InChI | InChI=1S/C23H28O6/c1-3-14-6-10-15(11-7-14)18-20(26)22(28)19(16-8-4-13(2)5-9-16)21(27,17(25)12-24)23(18,22)29/h4-11,17-20,24-29H,3,12H2,1-2H3/t17-,18?,19?,20?,21+,22+,23+/m1/s1 |
| InChIKey | LXEPEZPIHBYXDZ-YVLWGGILSA-N |
| XLogP | 0.36 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |