C22H17N3O3 — CID 22829716
N-methyl-2-nitro-4-[(E)-2-(5-phenyl-1,3-benzoxazol-2-yl)ethenyl]aniline (PubChem CID 22829716) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-methyl-2-nitro-4-[(E)-2-(5-phenyl-1,3-benzoxazol-2-yl)ethenyl]aniline.
| Compound Name | N-methyl-2-nitro-4-[(E)-2-(5-phenyl-1,3-benzoxazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 22829716 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-methyl-2-nitro-4-[(E)-2-(5-phenyl-1,3-benzoxazol-2-yl)ethenyl]aniline |
| SMILES | CNc1ccc(/C=C/c2nc3cc(-c4ccccc4)ccc3o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N3O3/c1-23-18-10-7-15(13-20(18)25(26)27)8-12-22-24-19-14-17(9-11-21(19)28-22)16-5-3-2-4-6-16/h2-14,23H,1H3/b12-8+ |
| InChIKey | OWXOVNZNSKJVLK-XYOKQWHBSA-N |
| XLogP | 5.62 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|