C15H17ClN2O5 — CID 22830377
2-(3-chlorophenoxy)ethyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 22830377) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 22830377 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCCOc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C15H17ClN2O5/c1-15(2)13(20)18(14(21)17-15)9-12(19)23-7-6-22-11-5-3-4-10(16)8-11/h3-5,8H,6-7,9H2,1-2H3,(H,17,21) |
| InChIKey | RPCRXCZMYJNSDA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|