C21H20F3NO6 — CID 22831243
4-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate (PubChem CID 22831243) has the molecular formula C21H20F3NO6 and a molecular weight of 439.39 g/mol. Its IUPAC name is 4-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22831243 |
| Molecular Formula | C21H20F3NO6 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCC3)C1CCN(C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C21H20F3NO6/c22-21(23,24)11-29-20(28)25-8-6-12(7-9-25)18(26)30-13-4-5-15-14-2-1-3-16(14)19(27)31-17(15)10-13/h4-5,10,12H,1-3,6-9,11H2 |
| InChIKey | OSPVYYAVJAFTTD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|