About (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
(1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 22831387) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 22831387 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CC[C@]1(C)C(=O)C2Br |
| InChI | InChI=1S/C10H15BrO/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-7H,4-5H2,1-3H3/t6?,7?,10-/m1/s1 |
| InChIKey | NJQADTYRAYFBJN-HNQUHTCLSA-N |
| XLogP | 2.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CID 22831387) is (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is CC1(C)C2CC[C@]1(C)C(=O)C2Br.
What is the InChIKey of (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is NJQADTYRAYFBJN-HNQUHTCLSA-N. The full InChI is InChI=1S/C10H15BrO/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-7H,4-5H2,1-3H3/t6?,7?,10-/m1/s1.
What are the key properties of (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
(1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 231.13 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 22831387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).