About tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate
tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate (PubChem CID 22831541) has the molecular formula C8H13N5O2
and a molecular weight of 211.23 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate |
| PubChem CID | 22831541 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/N)n1cncn1 |
| InChI | InChI=1S/C8H13N5O2/c1-8(2,3)15-7(14)12-6(9)13-5-10-4-11-13/h4-5H,1-3H3,(H2,9,12,14) |
| InChIKey | SKSIGJGFRUKGOA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate?
The IUPAC name of tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate (CID 22831541) is tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate.
What is the SMILES notation for tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate?
The canonical SMILES for tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate is CC(C)(C)OC(=O)/N=C(/N)n1cncn1.
What is the InChIKey of tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate?
The InChIKey is SKSIGJGFRUKGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2/c1-8(2,3)15-7(14)12-6(9)13-5-10-4-11-13/h4-5H,1-3H3,(H2,9,12,14).
What are the key properties of tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate?
tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate has a molecular weight of 211.23 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (NZ)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate is sourced from PubChem (CID 22831541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).