C21H42O6Si — CID 22831567
(3aS,4S,6R,7R,7aS)-6-(hydroxymethyl)-2,2-dimethyl-4-pent-4-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol;tert-butyl(trimethyl)silane (PubChem CID 22831567) has the molecular formula C21H42O6Si and a molecular weight of 418.65 g/mol. Its IUPAC name is (3aS,4S,6R,7R,7aS)-6-(hydroxymethyl)-2,2-dimethyl-4-pent-4-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol;tert-butyl(trimethyl)silane.
| Compound Name | (3aS,4S,6R,7R,7aS)-6-(hydroxymethyl)-2,2-dimethyl-4-pent-4-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol;tert-butyl(trimethyl)silane |
|---|---|
| PubChem CID | 22831567 |
| Molecular Formula | C21H42O6Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (3aS,4S,6R,7R,7aS)-6-(hydroxymethyl)-2,2-dimethyl-4-pent-4-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol;tert-butyl(trimethyl)silane |
| SMILES | C=CCCCO[C@H]1O[C@H](CO)[C@@H](O)[C@@H]2OC(C)(C)O[C@H]12.CC(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C14H24O6.C7H18Si/c1-4-5-6-7-17-13-12-11(19-14(2,3)20-12)10(16)9(8-15)18-13;1-7(2,3)8(4,5)6/h4,9-13,15-16H,1,5-8H2,2-3H3;1-6H3/t9-,10-,11+,12+,13+;/m1./s1 |
| InChIKey | HFMIVOYSCRCENC-GGEDQZLASA-N |
| XLogP | 3.69 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|