ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate

C13H20N2O2 — CID 22831820

IUPACethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cnc(C(C)C)nc1C(C)C
InChIInChI=1S/C13H20N2O2/c1-6-17-13(16)10-7-14-12(9(4)5)15-11(10)8(2)3/h7-9H,6H2,1-5H3
InChIKeyPKXKTXYISSIGBZ-UHFFFAOYSA-N
MW236.31 g/mol
LogP2.90
Rot. Bonds4

About ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate

ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate (PubChem CID 22831820) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate.

Molecular Properties

Compound Nameethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate
PubChem CID22831820
Molecular FormulaC13H20N2O2
Molecular Weight236.31 g/mol
Exact Mass236.15
IUPAC Nameethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cnc(C(C)C)nc1C(C)C
InChIInChI=1S/C13H20N2O2/c1-6-17-13(16)10-7-14-12(9(4)5)15-11(10)8(2)3/h7-9H,6H2,1-5H3
InChIKeyPKXKTXYISSIGBZ-UHFFFAOYSA-N
XLogP2.90
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.31
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate (CID 22831820) is ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate is CCOC(=O)c1cnc(C(C)C)nc1C(C)C.
What is the InChIKey of ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate?
The InChIKey is PKXKTXYISSIGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-6-17-13(16)10-7-14-12(9(4)5)15-11(10)8(2)3/h7-9H,6H2,1-5H3.
What are the key properties of ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate?
ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate has a molecular weight of 236.31 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-di(propan-2-yl)pyrimidine-5-carboxylate is sourced from PubChem (CID 22831820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).