About N-heptan-4-yl-1,3-benzodioxole-5-carboxamide
N-heptan-4-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 22831877) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is N-heptan-4-yl-1,3-benzodioxole-5-carboxamide.
Molecular Properties
| Compound Name | N-heptan-4-yl-1,3-benzodioxole-5-carboxamide |
| PubChem CID | 22831877 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-heptan-4-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCC(CCC)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO3/c1-3-5-12(6-4-2)16-15(17)11-7-8-13-14(9-11)19-10-18-13/h7-9,12H,3-6,10H2,1-2H3,(H,16,17) |
| InChIKey | YOBNUUGTIXQSPD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-heptan-4-yl-1,3-benzodioxole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-4-yl-1,3-benzodioxole-5-carboxamide?
The IUPAC name of N-heptan-4-yl-1,3-benzodioxole-5-carboxamide (CID 22831877) is N-heptan-4-yl-1,3-benzodioxole-5-carboxamide.
What is the SMILES notation for N-heptan-4-yl-1,3-benzodioxole-5-carboxamide?
The canonical SMILES for N-heptan-4-yl-1,3-benzodioxole-5-carboxamide is CCCC(CCC)NC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of N-heptan-4-yl-1,3-benzodioxole-5-carboxamide?
The InChIKey is YOBNUUGTIXQSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-3-5-12(6-4-2)16-15(17)11-7-8-13-14(9-11)19-10-18-13/h7-9,12H,3-6,10H2,1-2H3,(H,16,17).
What are the key properties of N-heptan-4-yl-1,3-benzodioxole-5-carboxamide?
N-heptan-4-yl-1,3-benzodioxole-5-carboxamide has a molecular weight of 263.34 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-4-yl-1,3-benzodioxole-5-carboxamide is sourced from PubChem (CID 22831877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).