C20H32O4 — CID 22832652
(3E)-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-2-methylhepta-3,6-diene-1,2,5-triol (PubChem CID 22832652) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3E)-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-2-methylhepta-3,6-diene-1,2,5-triol.
| Compound Name | (3E)-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-2-methylhepta-3,6-diene-1,2,5-triol |
|---|---|
| PubChem CID | 22832652 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3E)-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-2-methylhepta-3,6-diene-1,2,5-triol |
| SMILES | C=C(C(O)/C=C/C(C)(O)CO)[C@@H]1C[C@@H](O)[C@@]2(C)[C@@H]1[C@@H]1[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O4/c1-11-5-6-14-17(11)18-13(9-16(23)20(14,18)4)12(2)15(22)7-8-19(3,24)10-21/h7-8,11,13-18,21-24H,2,5-6,9-10H2,1,3-4H3/b8-7+/t11-,13+,14+,15?,16-,17-,18+,19?,20+/m1/s1 |
| InChIKey | UKLXBKNTSRRSJH-NBPNWECOSA-N |
| XLogP | 1.88 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|