C27H46O3 — CID 22832698
(3S,7R,9S,10S,13R,17R)-10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 22832698) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is (3S,7R,9S,10S,13R,17R)-10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3S,7R,9S,10S,13R,17R)-10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 22832698 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | (3S,7R,9S,10S,13R,17R)-10-(hydroxymethyl)-13-methyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3C(O)C=C4C[C@@H](O)CC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H46O3/c1-17(2)6-5-7-18(3)21-8-9-22-25-23(11-12-26(21,22)4)27(16-28)13-10-20(29)14-19(27)15-24(25)30/h15,17-18,20-25,28-30H,5-14,16H2,1-4H3/t18?,20-,21+,22?,23-,24?,25?,26+,27+/m0/s1 |
| InChIKey | HFNOEDZKKALPKD-VPALIZHHSA-N |
| XLogP | 5.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|