C21H36O3 — CID 22832764
(3aS,4R,5S,8aR)-5-(5-hydroxy-6-methoxy-6-methylheptan-2-yl)-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-4-ol (PubChem CID 22832764) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (3aS,4R,5S,8aR)-5-(5-hydroxy-6-methoxy-6-methylheptan-2-yl)-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-4-ol.
| Compound Name | (3aS,4R,5S,8aR)-5-(5-hydroxy-6-methoxy-6-methylheptan-2-yl)-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-4-ol |
|---|---|
| PubChem CID | 22832764 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (3aS,4R,5S,8aR)-5-(5-hydroxy-6-methoxy-6-methylheptan-2-yl)-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-4-ol |
| SMILES | C=C1CC[C@@H](C(C)CCC(O)C(C)(C)OC)[C@@H](O)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C21H36O3/c1-13-7-11-17(20(23)19-15(3)8-10-16(13)19)14(2)9-12-18(22)21(4,5)24-6/h8,14,16-20,22-23H,1,7,9-12H2,2-6H3/t14?,16-,17-,18?,19+,20+/m0/s1 |
| InChIKey | VILFYEDUYHTBBR-ILZFJJQQSA-N |
| XLogP | 4.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|