C20H24O5 — CID 22833162
(3R,5S,7E,11R)-3,8-dimethyl-11-prop-1-en-2-yl-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-diene-6,9,15-trione (PubChem CID 22833162) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R,5S,7E,11R)-3,8-dimethyl-11-prop-1-en-2-yl-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-diene-6,9,15-trione.
| Compound Name | (3R,5S,7E,11R)-3,8-dimethyl-11-prop-1-en-2-yl-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-diene-6,9,15-trione |
|---|---|
| PubChem CID | 22833162 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3R,5S,7E,11R)-3,8-dimethyl-11-prop-1-en-2-yl-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-diene-6,9,15-trione |
| SMILES | C=C(C)[C@@H]1CCC2=CC(C[C@@]3(C)O[C@@H]3C(=O)/C=C(\C)C(=O)C1)OC2=O |
| InChI | InChI=1S/C20H24O5/c1-11(2)13-5-6-14-8-15(24-19(14)23)10-20(4)18(25-20)17(22)7-12(3)16(21)9-13/h7-8,13,15,18H,1,5-6,9-10H2,2-4H3/b12-7+/t13-,15?,18-,20-/m1/s1 |
| InChIKey | MFBDZEVCKCRBMW-SQBQFDTMSA-N |
| XLogP | 2.85 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|